Primery_reshyonnykh_zadach


НЕОРГАНИКА


Углерод 6С.
Электронная конфигурация: 1s22s22p2

В нормальном состоянии атом углерода имеет два неспаренных валентных электрона (образуя степени окисления 0, +2, -2), в возбуждённом же состоянии - четыре валентных электрона (+4).
Кремний 14Si
Электронная конфигурация: 1s22s22p63s23p2

В нормальном состоянии атом кремния имеет два неспаренных валентных электрона (образуя степени окисления 0, +2, -2), в возбуждённом же состоянии - четыре валентных электрона (+4).
Натрий 11Na+
-67310664210Электронная конфигурация: 1s22s22p63s1

В нормальном состоянии атом натрия имеет один неспаренный валентный электрон, который атом металла может отдать на образование связи (степень окисления +1), в возбуждённом же состоянии атом натрия превращается в +1заряженный ион и не имеет свободных электронов.
4.
Степень диссоциации кислоты равна отношению продиссоциированных молекул кислоты к общему числу её молекул. Исходя из уравнения закона разбавления Оствальда для слабых электролитов:
Ка = α2˖См, где α - степень диссоциации, Ка - константа диссоциации кислоты.
Ka (HClO) = 3,184˖10-8
Найдём степень диссоциации при заданной концентрации См (HClO) = 0,001 моль/л
α˖ = √[Ka (HClO) / См (HClO)] = √ (3,184˖10-8 / 0,001) = 0,00564
Нормальная концентрация Сн или молярная концентрация эквивалента С (1/z) — количество эквивалентов данного вещества в 1 литре раствора. Нормальную концентрацию находят по формуле:
, где z — число эквивалентности.
Для одноосновной кислоты HClO число эквивалентности составит 1.
Тогда Сн (HClO) = 1* См (HClO) = 0,001 моль•экв/л
Следуя из определения степени диссоциации электролита, получим, что
С (H+) = α˖Cм (HClO)
Подставим в формулу найденное значение α˖
С (H+) = 0,00564*0,001 моль/л = 5,64˖10-6 моль/л
pH = -lg C(H+) = - lg (5,64˖10-6) = 5,249
Исходя из того, что ионное произведение воды Kw = 10-14,
Kw = C(H+)˖ C(OH-) = 10-14
C(OH-) = 10-14 / C(H+)˖= 10-14 / 5,64˖10-6 = 1,773˖10-9
pOH = - lg C(OH-) = 8,751
Ответ: α˖ = 0,00564 ; Сн (HClO) = 0,001 моль•экв/л ; pH = 5,249 ; C(OH-) = 1,773˖10-9 ;
pOH = 8,751
АНАЛИТИКА

I способ (по основному уравнению титриметрического анализа):
1) Рассчитываем титр и молярную концентрацию эквивалента раствора щавелевой кислоты H2C2O4*2H2O:
Т = m/V = 2,3500 /200,0 = 0,01175 г/мл
С(1/2 H2C2O4*2H2O) = (Т∙1000)/М (1/2 H2C2O4*2H2O) = (0,01175 *1000)/ 63,03302 = 0,18641 моль/л
2) Рассчитываем молярную концентрацию эквивалента раствора щёлочи KOH и ее титр:
С(1/2 H2C2O4*2H2O)∙V(1/2 H2C2O4*2H2O) = С(KOH)∙V(KOH)
С(KOH) = [С(1/2 H2C2O4*2H2O)∙V(1/2 H2C2O4*2H2O)]/ V(KOH) =
= 0,18651 * 20 / 19,36 = 0,19267 моль/л
Т(KOH) = С(KOH)∙M(1/1 KOH)/1000 = (0,19257*56,10564)/1000 = 0,01081 г/мл
II способ (через титр рабочего раствора по определяемому веществу):
1) Рассчитываем как и в первом случае титр и молярную концентрацию эквивалента раствора щавелевой кислоты H2C2O4*2H2O:
Т = m/V = 2,3500 /200,0 = 0,01175 г/мл
С(1/2 H2C2O4*2H2O) = (Т∙1000)/М (1/2 H2C2O4*2H2O) = (0,01175 *1000)/ 63,03302 = 0,18641 моль/л
2) Далее рассчитываем титр раствора щавелевой кислоты по гидроксиду калия:
Т(H2C2O4*2H2O /KOH) = [С(1/2 H2C2O4*2H2O)∙ M(1/1 KOH)]/1000 =
= (0,18641 * 56,10564)/1000 = 0,01046 г/мл
2) Рассчитываем титр гидроксида калия и его молярную концентрацию эквивалента:
Т(KOH) = [Т(H2C2O4*2H2O /KOH) * V(H2C2O4*2H2O)]/ V(KOH) =
= (0,01046*20,00)/19,36 = 0,01081 г/мл
С(KOH) = Т(KOH)∙1000/ M(1/1 KOH) = (0,01081 * 1000)/ 56,10564 = 0,19267 моль/л
Ответ: С(KOH) = 0,19267 моль/л ; Т(KOH) = 0,01081 г/мл.

С(1/2 Na2H2Y)∙V(1/2 Na2H2Y) = С(1/2 MgSO4)∙V(1/2 MgSO4)
С(1/2 Na2H2Y)∙= С(1/2 MgSO4)∙V(1/2 MgSO4)/ V(1/2 Na2H2Y)
Поскольку у нас было произведено три титрования, то было получено три результата объёма азотной кислоты.
Возьмём среднее арифметическое значение:
V(1/2 Na2H2Y) = inVin= (9,85+10,00 +9,90)3=9,9167 см3
С(1/2 Na2H2Y)∙= 0,05*10/9,9167 = 0,0504 моль/л
Поправочный коэффициент равен отношению истинной молярной концентрации эквивалента Cист рабочего раствора к округленной табличной молярной концентрации эквивалента Cтабл, для которой заранее рассчитано, какой массе определяемого вещества соответствует данный объем рабочего раствора.

K = 0,0504/0,05 = 1,008
Найдём титр Трилона Б по MgSO4:
Т(1/2 Na2H2Y) = С(1/2 Na2H2Y)∙M(1/2 Na2H2Y)/1000
Т(1/2 Na2H2Y)Mg = 0,0504*186,12/1000 = 0,00938 г/см3
Ответ: С(1/2 Na2H2Y)∙= 0,0504 моль/л; K = 1,008; Т(1/2 Na2H2Y)Mg) = 0,00938 г/см3
Теперь рассчитаем титр Трилона по CaSO4 Т(1/2 Na2H2Y)Ca:

К уст (Мg2+)/ К уст (Ca2+) = [H2Y - (CaSO4)]/[ H2Y - (MgSO4] = 4,9•108 / 5,0•1010 = 0,0098
[H2Y - (CaSO4)] = 0,0098 * [H2Y - (MgSO4)]
Теперь перейдём к титрам через формулу перевода

M = T/0,001M в-ва[H2Y - (CaSO4)] = 1000*T (CaSO4)/Mr(Na2H2Y)
[H2Y - (MgSO4)] = 1000*T (MgSO4)/Mr(Na2H2Y)
[H2Y - (CaSO4)] = 0,0098 * [H2Y - (MgSO4)]
1000*Т(1/2 Na2H2Y)CaMr(Na2H2Y)=0,0098 1000*Т(1/2 Na2H2Y)MgMr(Na2H2Y) Т(1/2 Na2H2Y)Ca1=0,0098 Т(1/2 Na2H2Y)Mg1Т(1/2 Na2H2Y)Ca = 0,0098* Т(1/2 Na2H2Y)Mg = 0,0098*0,00938 г/см3 = 0,000091924 г/см3
Ответ: Т(1/2 Na2H2Y)Ca = 0,000091924 г/см3
ХИМИЧЕСКАЯ КИНЕТИКА
Задача 1.
Во сколько раз увеличится скорость реакции, протекающей при температуре T = 298 К, если энергия активации ЕА уменьшится на 4 кДж/моль.
Решение:
Существует уравнение, связывающее константу скорости реакции с энергией активации и температурой, это уравнение Аррениуса:
kT=A*exp-EART, где R - универсальная газовая постоянная R = 8,314; А - предэкспоненциальный множитель, который не зависит от температуры.
Изменение скорости реакции определяется отношением констант скоростей реакции друг к другу при разных температурах или энергиях активации и при неизменности концентрации реагирующих веществ, т.е.
v2v1= k2k1= exp-EA2RTexp-EA1RT= exp-(EA1-4 кДж/моль)RTexp-EA1RT= exp-(EA1-4 кДж/моль)RT--EA1RT = exp-EA1+ 4 кДж/моль + EA1 RT = exp 4000ДжмольRT = exp 4000Джмоль8,314 Джмоль К *298 К =exp1,614=5,025
Ответ: Реакция увеличится в 5 раз
7) Химическое равновесие. Укажите условия смещения равновесия. Константа химического равновесия. Укажите фактор, влияющий на величину константы равновесия. Напишите выражение константы химического равновесия для реакции:
FeCl3 + 3KCN ↔ Fe(CNS)3 + 3KClРеакция находится в состоянии химического равновесия, когда скорость прямой реакции равна скорости обратной. Химическое равновесие может смещаться в ту или иную сторону под действием внешних факторов: температуры Т, давления р, концентрации одного из реагентов Сi. Условие смещения равновесия описывает правило Ле-Шателье:
«Если на систему, находящуюся в состоянии равновесия, оказывается внешнее воздействие, то равновесие сместится в сторону, уменьшающее оказанное воздействие»
Разберём подробнее.
1) Температура. При увеличении Т равновесие сместится вправо для эндотермических реакций (в которых тепловой эффект отрицательный). При уменьшении Т равновесие сместится вправо для экзотермических реакций (в которых тепловой эффект положительный).
2) Давление. При увеличении давления равновесие сместится в сторону продуктов в случае реакций, протекающих с уменьшением объёма. Обратное справедливо. Если сумма частиц исходных веществ равна сумме частиц продуктов реакции, т.е. объём в результате процесса не меняется, то химическое равновесие в данной реакции не будет зависеть от давления.
3) Концентрация. Увеличение концентрации исходных веществ смещает равновесие вправо в сторону уменьшения количества этих компонентов, а увеличение концентрации продуктов смещает равновесие влево.
Для реакции aA + bB = cC + dD константа равновесия есть отношение активностей продуктов реакции к активностям исходных веществ в степенях их коэффициентов
Ka=aCcaDdaAaaBbДля реакции FeCl3 + 3KCN ↔ Fe(CNS)3 + 3KCl константа равновесия будет выглядеть следующим образом:
Ka=a(FeCNS3)1a(KCl)3a(FeCl3)1a(KCN)3
Омыление - это гидролиз сложных эфиров под действием щёлочи. При этом получается соль органической кислоты и спирт. Запишем реакцию омыления этилового эфира уксусной кислоты (этилацетата) гидроксидом натрия:
CH3-COO-C2H5 + NaOH => CH3-COONa + C2H5OH
k (T=293К) = 0,0847 л/(моль•с)
k (T=298К) = 0,109 л/(моль•с)
С (эфир) = С (NaOH) = 0, 025 моль/л
Уравнение Аррениуса, описывающее температурную зависимость константы скорости и устанавливающее зависимость константы от энергии активации.

где R - универсальная газовая постоянная; A - предэкспоненциальный множитель, который не зависит от температуры, а определяется только видом реакции; EA - энергия активации, которую можно охарактеризовать как некоторую пороговую энергию: грубо говоря, если энергия сталкивающихся частиц меньше EA, то при столкновении реакция не произойдет, если энергия превышает EA, реакция произойдет. Энергия активации не зависит от температуры. Существуют вещества, способные уменьшить энергию активации для данной реакции. Такие вещества называют катализаторами. В биологических реакциях в качестве катализаторов выступают ферменты. Катализаторы специфичны тем, что ускоряют ход реакции, самостоятельно в ней не участвуя.
Если прологарифмировать уравнение Аррениуса, то получим выражение:
ln (kT) = lnA - EA/RT
Подставим значения констант скорости реакции при двух разных температурах в прологарифмированное уравнение Аррениуса и найдём
значение энергии активации, которая не зависит от температуры.
EA/RT = lnA - ln (kT)
lnA = EA/RT + ln (kT)
Подставим теперь значения констант скорости при разных температурах:
lnA = EA/8, 314*293 + ln (0,0847)
lnA = EA/8, 314*298 + ln (0,109)
EA/8, 314*293 -2,469 = EA/8, 314*298 - 2,216
EA/8, 314*293 - EA/8, 314*298 = 2,469 - 2,216
293*298* EA/8, 314*293 - 293*298* EA/8, 314*298 = 0,253*293*298
298* EA/8, 314 - 293* EA/8, 314 = 22090,442
5* EA/8, 314 = 22090,442
EA = 36732 (Дж/моль)

Теперь найдём период полупревращения τ1/2 реакции при
С (эфир) = С (NaOH) = 0, 025 моль/л
k 298 = 0,109 л/(моль•с)
CH3-COO-C2H5 + NaOH => CH3-COONa + C2H5OH
Чтобы найти τ1/2 нужно знать порядок реакции. Поскольку узнать его не представляется возможным, то предположим, что реакция омыления этилацетатата - второго порядка, поскольку периоды полупревращения реакций нулевого и первого порядка не зависят от начальной концентрации

τ1/2 = 1/ С (эфир)* k 298
τ1/2 = 1/(0, 025 * 0,109 )
τ1/2 = 1/ 0,002725 = 367 c
Ответ: EA = 36732Дж/моль ; τ1/2 = 367 c
ТЕРМОДИНАМИКА

CH3COCH3 (ж) + I2 (тв) + 2KOH (тв) = CH3I (ж) + CH3COOK (тв) + KI (тв) + H2O (ж)
Т = 298 К, p = const (изобарные условия)
ΔrHO - ?
ΔfHO (CH3COCH3 (ж) = -217,57 кДж/моль;
ΔfHO (I2 (тв) = 0
ΔfHO (KOH (тв) = -424,76 кДж/моль;
ΔfHO (CH3I (ж) = + 162,7 кДж/моль;
ΔfHO (CH3COOK (тв) = -722,6 кДж/моль;
ΔfHO (KI (тв) = - 327,61 кДж/моль;
ΔfHO (H2O (ж) = - 285,84 кДж/моль.
Данные по энтальпиям взяты из книг:
В. В. Ерёмин, С. И. Каргов "Задачи по физической химии"
Н.В. Карякин "Основы химической термодинамики"
ΔrHO = ΔfHO (CH3COOK (тв) + ΔfHO (CH3I (ж) + ΔfHO (KI (тв) + ΔfHO (H2O (ж) -
ΔfHO (CH3COCH3 (ж) - 2* ΔfHO (KOH (тв)
ΔrHO = -722,6+162,7- 327,61-285,84+217,57+2*424,76 = - 106,26 (кДж/моль)
Ответ: - 106,26 кДж/моль
Количественно зависимость константы равновесия от температуры описывается уравнением изобары химической реакции (изобары Вант-Гоффа)

Интегрирование данного уравнения в предположении, что ΔrHO реакции не зависит от температуры (справедливо в узких интервалах температур), дает:


где C – константа интегрирования. Таким образом, зависимость ln KP от 1/Т должна быть линейной, а наклон прямой равен –ΔrH /R.
ΔrH данной реакции отрицательна, следовательно увеличение температуры приведёт к уменьшению KP реакции.


1. T1 = 340C
2. Метилстеарат.
3. T2 = 250C
4. Температура плавления (полного перехода в жидкое состояние) суппозиториев не должна превышать 370C, можно применять для данных целей смеси с содержанием компонента B выше 28%
5. В точке а находятся две фазы: расплав переменного состава и твёрдый компонент А. Число степеней свободы в данной точке равно 1.
6. В точке а имеем 2 фазы: жидкий расплав парафина и метилстеарата и твёрдый компонент парафин.
Соотношение между количествами фаз найдём по правилу рычага:
m (ж) / m (тв) = Ta ba / a la
m (ж) / m (тв) = 22 / 28
m (ж) / m (тв) = 1 / 1,33
m (тв) = 1,33 *m (ж)
2 = 1,33 *m (ж) + m (ж)
m (ж) = 0,857 кг, m (тв) = 1,143 кг
ЭЛЕКТРОХИМИЯ

Решение:
Составим схему электролиза:
2 (−)катод 2H+ + 2e- → H20↑ − восстановление
1 (+) анод 4OH- − 4e- → O2↑ + 2H2O − окисление
Общая схема электролиза:
2H2O → O2↑ + 2H2↑
На аноде выделяется кислород.
m(O2) = 4 г, ∆t = 45 мин = 2700 c, M(O2) = 32 г/моль
Второй закон Фарадея записывается в следующем виде:

где M — молярная масса данного вещества, образовавшегося в результате электролиза, г/моль;
I — сила тока, пропущенная через раствор, А;
∆t — время, в течение которого проводился электролиз, с;
F — постоянная Фарадея, F = 96500 Кл·моль−1;
n — число участвующих в процессе электронов
Из этой формулы найдём силу тока
I= m•n•FM•∆tI= 4•4•9650032•2700= 17,87 А
Ответ: I= 17,87 А
/
Для проводящих сферических частиц скорость электрофореза υ может быть рассчитана по уравнению:
us = ζ (ε ε0E/4π η), где E - напряжённость электрического поля,;
ε - диэлектрическая проницаемость среды;
η - вязкость среды;
ζ (дзета-потенциал) - значение электрического потенциала на расстоянии от поверхности, где скорость течения жидкости обращается в нуль
us = 18 мм/15 мин = 18•10-3 м/9•102 с = 2•10-5 м/c
Подставим все значения величин в формулу и найдём дзета-потенциал2•10-5 = ζ *(81*8,85e-12*600)/(4*3,14*1e-3)
2e-5 = ζ *(4,3e-7)/ 0,01256
2e-5 = ζ *3,4236e-5
ζ = 0,5842 В
Ответ: ζ = 0,5842 В
1. Электрофорез (electrophoresis) - направленное перемещение заряженных частиц в дисперсионной среде под действием внешнего электрического поля
2.
Под действием постоянного электрического тока положительная часть мицеллы будет двигаться к катоду, а отрицательные противоионы SO42- – к положительному аноду.


Cd + Sn(SO4)2 (0,5 M) ↔ CdSO4 (0,1 M) + SnSO4 (0,01 M)
а) Найдём из справочника значения электродных потенциалов олова и кадмия
E0 (Sn4+/Sn2+) = + 0,15 В
E0 (Cd2+/Cd) = -0,40 В
У кадмия стандартный электродный потенциал ниже, чем у олова, поэтому кадмий, как более активный металл, окисляется и является анодом (−). Олово является катодом (+), на нём происходит восстановление. Запишем схему:
(−) Cd│ Cd2+││ Sn4+ / Sn2+│ Sn (+)
Анод (−) Cd − 2e- ↔ Cd2+ − окисление
Катод (+) Sn4+ + 2e- ↔ Sn2+ − восстановление
Электроны движутся от анода (-) к катоду (+).
б) Элетродный потенциал отдельного электрода находят по уравнению Нернста
E= E0+ 0,059nlgOxRed , где [Ox] - концентрация окисленной формы вещества; [Red] - концентрация восстановленной формы, n - число электронов, участвующих в реакции.
Eанод = E0(Cd2+/Cd)+ 0,0592lg Cd2+ Eкатод= E0(Sn4+/Sn2+)+ 0,0592lg Sn4+ Sn2+ Теперь найдём конкретные значения потенциалов электродов
[Cd2+] = 0,1 моль/л , [Sn2+] = 0,01 моль/л, [Sn4+] = 0,5 моль/л
Eанод = -0,40 + 0,0592lg 0,1 = -0,40 - 0,0295 = -0,4295 (В)
Eкатод= + 0,15 + 0,0592lg 0,01 0,5= + 0,15 + 0,0295*(-1,7) = 0,0999 (В)
ЭДС ∆E можно вычислить ∆E = Eкатод − Еанод∆E = 0,0999 - (-0,4295) = 0,5294 (В)
в) Найдём энергию Гиббса реакции гальванического элемента:
Δ G= - n ∙F ∙ΔE , где F = 96500 Кл/моль - постоянная Фарадея.
Δ G= - 2∙9500 ∙0,5294 = - 102174,2 (Дж/моль)
Теперь найдём константу равновесия Kp из уравнения:
Δ G= - R ∙T ∙lnKp
lnKp = - Δ GR ∙T
lnKp = + 102174,2 / (8,314*298,15) = 102174,2 / 2478,8191 = 41,2189
Kp = elnKp = 7,96 •1018
г) При Δ G = 0, ЭДС гальванического элемента ∆E тоже становится равным нулю (а константа равновесия Kp обращается в единицу - реакция не идёт)
∆E = 0, Eанод = EкатодEанод = E0(Cd2+/Cd)+ 0,0592lg Cd2+ Eкатод= E0(Sn4+/Sn2+)+ 0,0592lg Sn4+ Sn2+E0Cd2+Cd+ 0,0592lg Cd2+ = E0(Sn4+/Sn2+)+ 0,0592lg Sn4+ Sn2+- 0,40 + 0,0295 lg Cd2+ = 0,15 + 0,0295 lg Sn4+ Sn2+0,15 + 0,40 = + 0,0295 lg Sn4+ Sn2+ - 0,0295 lg Cd2+0,55 = + 0,0295 lg Sn4+ Sn2+Cd2+lg Sn4+ Sn2+Cd2+ = 18,644
Sn4+ Sn2+Cd2+ = 4,4•1018
При таком соотношении концентраций веществ, Δ G гальванического элемента будет равно 0.
КОРРОЗИЯ


Коррозия - это разрушение металла под воздействием окружающей среды.
По механизму коррозионного процесса различают химическую и электрохимическую коррозию.
По характеру реакций электрохимическую коррозию разделяют на водородную и кислородную коррозию
Если происходит восстановление ионов H3O+ или молекул воды H2O, говорят о водородной коррозии или коррозии с водородной деполяризацией. Она происходит в кислых средах при pH < 7. Водородная коррозия самая агрессивная, скорость её выше, чем бескислотной.
Если водород не выделяется, что часто происходит в нейтральной (pH = 7) или сильно щелочной среде (pH > 7), происходит восстановление кислорода и здесь говорят о кислородной коррозии или коррозии с кислородной деполяризацией. Кислородная коррозия усиливается с увеличением щёлочности (pH) среды :
(-) Анод Zn − 2е- → Zn2+ ; E0 = - 0,76 В
(+) Катод O2 + 2H2O + 4e− → 4OH− ; E0 = + 0,41 В
Общая реакция коррозии: 2Zn + O2 + 2H2O → 2Zn(OH)2
Конечным продуктом реакции коррозии цинка является плёнка гидроксида цинка, которая в некоторой степени замедляет дальнейшую коррозию металла.
(-) Анод Sn − 3е- → Sn2+ ; E0 = - 0,14 В
(+) Катод O2 + 2H2O + 4e− → 4OH− ; E0 = + 0,41 В
Общая реакция коррозии: 2Sn + O2 + 2H2O → 2Sn(OH)2
Конечным продуктом реакции коррозии олова является плёнка гидроксида олова, которая в некоторой степени замедляет дальнейшую коррозию металла.
Скорость коррозии металлов зависит от множества факторов:
Температура металла и окружающей среды (повышение T ускоряет все коррозионные процессы)
Образование продуктов коррозии, защитная плёнка на поверхности корродируемого металла (замедляет коррозию)
Наличие влаги и электролитов в окружающей среде (чем больше - тем выше коррозия)
pH среды (чем сильнее pH отличается от нейтрального значения 7, тем активнее коррозия)
Поэтому все коррозионные среды делятся на:
неагрессивные,
слабоагрессивные,
среднеагрессивныесильноагрессивные.

Чем меньше величина электродного потенциала, тем сильнее выражены восстановительные свойства атомов, т.е. тем активнее металл.
EZn3+/Zn0 = − 0,76 В
EFe2+/Fe0 = − 0,440 В
Цинк является более активным металлом (величина электродного потенциала меньше), он окисляется при электрохимической коррозии и является анодом.
Железо, как менее активный в паре металл, не подвергается коррозии и является катодом. На катоде происходит восстановление воды.
На этом и основан принцип цинковой протекторной защиты: под влиянием морской воды разрушается цинковая пластина, а не стальная конструкция.
− Zn│H2O│Fe +
Анод Zn − 2е- → Zn2+
Катод 2H2O + 2e- → 2OH- + H2 На катоде возможно протекание сразу нескольких
Катод 2H2O + O2 + 4e- → 4OH- процессов
Общая реакция коррозии:
Zn + 2H2O → Zn(OH)2 + H2↑
2Zn + 2H2O + O2 → 2Zn(OH)2
ОРГАНИКА
Задание № 2


Хлорэтилен (винилхлорид)

Получение:
1) дегидрохлорирование 1,2-дихлорэтана или 1,1-дихлорэтана спиртовым раствором гидроксида натрия или калия при нагревании

2) пропускание ацетилена через концентрированный раствор соляной кислоты в присутствии хлорида ртути — в лабораторной практике используется редко:

3) Каталитическая дегидратация этиленхлоргидрина
4) Винилхлорид также можно получить при взаимодействии ацетальдегида с пентахлоридом фосфора


На данный момент существуют три основных способа получения винилхлорида, реализованные в промышленных масштабах:
каталитическое газофазное гидрохлорирование ацетилена;
комбинированный метод на основе этилена и ацетилена;
сбалансированный по хлору метод на основе этилена.
Строение винилхлорида:

Химические свойства:
1) Хлористый винил легко реагирует с хлором как в жидкой, так и газовой фазе, образуя 1,1,2-трихлорэтан:

2) Винилхлорид присоединяет галогенводороды по двойной связи в соответствии с правилом Марковникова только в присутствии катализаторов (хлорид железа (III), хлорид цинка и др.) при повышенной температуре, образуя 1,1-дигалогеналканы:


3) Вступает в реакцию Фриделя-Крафтса с бензолом в присутствии хлорида алюминия, образуя 1,1-дифенилэтан:

4) Реакции замещения по атому хлора


5) Реакция полимеризации

Задание № 4

Масляная (бутановая) кислота С3Н7СООН  относится к одноосновным насыщенным карбоновым кислотам. Щавелевая (этандиовая) кислота НООССООН — двухосновная предельная карбоновая кислота. Линолевая кислота — одноосновная ненасыщенная карбоновая кислота с двумя изолированными двойными связями
CH3(CH2)3-(CH2CH=CH)2(CH2)7COOH.
Фталевая кислота (1,2-бензолдикарбоновая кислота) — простейший представитель двухосновных ароматических карбоновых кислот.

Фталевая кислота проявляет все химические свойства дикарбоновых кислоты:
1) Кислотность
Аренкарбоновые кислоты превышают по кислотности насыщенные и  непредельные карбоновые кислоты.

2) Дегидратация
При нагревании в присутствии дегидратирующих агентов легко превращается во фталевый ангидрид:

3) Реакции карбоксильной группы
Нагревание аренкарбоновых кислот в присутствии медного порошка выше температуры в 200 0С приводит к декарбокилированию.

4) Реакции замещения в ароматическом кольце


Практическое применение имеют производные фталевой кислоты – ангидрид, имид, сложные эфиры.

Для определения кислоты от веществ, не дающих кислотную реакцию, можно воспользоваться индикатором, таким как лакмус.
Качественной реакцией именно на щавелевую кислоту является реакция с солями меди.

Образуются зелено-голубые кристаллы оксалата меди, которые выпадают в осадок. В двух других пробирках при добавлении хлорида меди осадка не образуется.

Приложенные файлы

  • docx 18463070
    Размер файла: 5 MB Загрузок: 0

Добавить комментарий